C11H11BrF2N2O — CID 99824677
(3R)-3-(5-bromo-2,4-difluoroanilino)-1-methylpyrrolidin-2-one (PubChem CID 99824677) has the molecular formula C11H11BrF2N2O and a molecular weight of 305.12 g/mol. Its IUPAC name is (3R)-3-(5-bromo-2,4-difluoroanilino)-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-(5-bromo-2,4-difluoroanilino)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 99824677 |
| Molecular Formula | C11H11BrF2N2O |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | (3R)-3-(5-bromo-2,4-difluoroanilino)-1-methylpyrrolidin-2-one |
| SMILES | CN1CC[C@@H](Nc2cc(Br)c(F)cc2F)C1=O |
| InChI | InChI=1S/C11H11BrF2N2O/c1-16-3-2-9(11(16)17)15-10-4-6(12)7(13)5-8(10)14/h4-5,9,15H,2-3H2,1H3/t9-/m1/s1 |
| InChIKey | CLSPNEREGFWNIJ-SECBINFHSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|