About 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one
3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one (PubChem CID 106259071) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one |
| PubChem CID | 106259071 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(Nc2cc(N)ns2)C1=O |
| InChI | InChI=1S/C8H12N4OS/c1-12-3-2-5(8(12)13)10-7-4-6(9)11-14-7/h4-5,10H,2-3H2,1H3,(H2,9,11) |
| InChIKey | KVEMAUSYKZPELR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one?
The IUPAC name of 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one (CID 106259071) is 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one.
What is the SMILES notation for 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one?
The canonical SMILES for 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one is CN1CCC(Nc2cc(N)ns2)C1=O.
What is the InChIKey of 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one?
The InChIKey is KVEMAUSYKZPELR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4OS/c1-12-3-2-5(8(12)13)10-7-4-6(9)11-14-7/h4-5,10H,2-3H2,1H3,(H2,9,11).
What are the key properties of 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one?
3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one has a molecular weight of 212.28 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-1,2-thiazol-5-yl)amino]-1-methylpyrrolidin-2-one is sourced from PubChem (CID 106259071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).