C15H21N3O2S — CID 106261095
4-methoxy-2-[1-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]phenol (PubChem CID 106261095) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-methoxy-2-[1-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]phenol.
| Compound Name | 4-methoxy-2-[1-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 106261095 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-methoxy-2-[1-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]phenol |
| SMILES | COc1ccc(O)c(C(C)Nc2nnc(CC(C)C)s2)c1 |
| InChI | InChI=1S/C15H21N3O2S/c1-9(2)7-14-17-18-15(21-14)16-10(3)12-8-11(20-4)5-6-13(12)19/h5-6,8-10,19H,7H2,1-4H3,(H,16,18) |
| InChIKey | TUNPGZCSRVQDAN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|