C13H17BrF2N2O — CID 106263803
2-[(3-bromo-2,6-difluorophenyl)methylamino]-N-ethyl-N-methylpropanamide (PubChem CID 106263803) has the molecular formula C13H17BrF2N2O and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylamino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylamino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 106263803 |
| Molecular Formula | C13H17BrF2N2O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylamino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H17BrF2N2O/c1-4-18(3)13(19)8(2)17-7-9-11(15)6-5-10(14)12(9)16/h5-6,8,17H,4,7H2,1-3H3 |
| InChIKey | SQQMZNXLRKYRIR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|