C15H11BrF2N2O — CID 106263819
2-[(3-bromo-2,6-difluorophenyl)methylamino]-3-methoxybenzonitrile (PubChem CID 106263819) has the molecular formula C15H11BrF2N2O and a molecular weight of 353.17 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylamino]-3-methoxybenzonitrile.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylamino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 106263819 |
| Molecular Formula | C15H11BrF2N2O |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylamino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1NCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H11BrF2N2O/c1-21-13-4-2-3-9(7-19)15(13)20-8-10-12(17)6-5-11(16)14(10)18/h2-6,20H,8H2,1H3 |
| InChIKey | GJTOWIRCGOMFBU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|