C15H12Br2N2O2 — CID 107741174
2-[(3,5-dibromo-4-hydroxyphenyl)methylamino]-3-methoxybenzonitrile (PubChem CID 107741174) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is 2-[(3,5-dibromo-4-hydroxyphenyl)methylamino]-3-methoxybenzonitrile.
| Compound Name | 2-[(3,5-dibromo-4-hydroxyphenyl)methylamino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107741174 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 2-[(3,5-dibromo-4-hydroxyphenyl)methylamino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1NCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O2/c1-21-13-4-2-3-10(7-18)14(13)19-8-9-5-11(16)15(20)12(17)6-9/h2-6,19-20H,8H2,1H3 |
| InChIKey | YHOCASLEFVCWSQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |