C16H13BrF2N2 — CID 106263980
3-[N-[(3-bromo-2,6-difluorophenyl)methyl]anilino]propanenitrile (PubChem CID 106263980) has the molecular formula C16H13BrF2N2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 3-[N-[(3-bromo-2,6-difluorophenyl)methyl]anilino]propanenitrile.
| Compound Name | 3-[N-[(3-bromo-2,6-difluorophenyl)methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 106263980 |
| Molecular Formula | C16H13BrF2N2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 3-[N-[(3-bromo-2,6-difluorophenyl)methyl]anilino]propanenitrile |
| SMILES | N#CCCN(Cc1c(F)ccc(Br)c1F)c1ccccc1 |
| InChI | InChI=1S/C16H13BrF2N2/c17-14-7-8-15(18)13(16(14)19)11-21(10-4-9-20)12-5-2-1-3-6-12/h1-3,5-8H,4,10-11H2 |
| InChIKey | ZWGJFABBCONAMW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|