C16H15BrF2O2 — CID 106264403
(1R)-1-[2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-methylphenyl]ethanol (PubChem CID 106264403) has the molecular formula C16H15BrF2O2 and a molecular weight of 357.19 g/mol. Its IUPAC name is (1R)-1-[2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-methylphenyl]ethanol.
| Compound Name | (1R)-1-[2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-methylphenyl]ethanol |
|---|---|
| PubChem CID | 106264403 |
| Molecular Formula | C16H15BrF2O2 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (1R)-1-[2-[(3-bromo-2,6-difluorophenyl)methoxy]-5-methylphenyl]ethanol |
| SMILES | Cc1ccc(OCc2c(F)ccc(Br)c2F)c([C@@H](C)O)c1 |
| InChI | InChI=1S/C16H15BrF2O2/c1-9-3-6-15(11(7-9)10(2)20)21-8-12-14(18)5-4-13(17)16(12)19/h3-7,10,20H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | MQPIUXAYVXVBFF-SNVBAGLBSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|