C18H22O2 — CID 61481674
1-[2-[(2,5-dimethylphenyl)methoxy]-5-methylphenyl]ethanol (PubChem CID 61481674) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)methoxy]-5-methylphenyl]ethanol.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)methoxy]-5-methylphenyl]ethanol |
|---|---|
| PubChem CID | 61481674 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)methoxy]-5-methylphenyl]ethanol |
| SMILES | Cc1ccc(C)c(COc2ccc(C)cc2C(C)O)c1 |
| InChI | InChI=1S/C18H22O2/c1-12-5-7-14(3)16(9-12)11-20-18-8-6-13(2)10-17(18)15(4)19/h5-10,15,19H,11H2,1-4H3 |
| InChIKey | ZAEYZQXJACFGNL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |