C17H19BrO2 — CID 78944614
(1S)-1-[5-bromo-2-[(2,5-dimethylphenyl)methoxy]phenyl]ethanol (PubChem CID 78944614) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is (1S)-1-[5-bromo-2-[(2,5-dimethylphenyl)methoxy]phenyl]ethanol.
| Compound Name | (1S)-1-[5-bromo-2-[(2,5-dimethylphenyl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 78944614 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (1S)-1-[5-bromo-2-[(2,5-dimethylphenyl)methoxy]phenyl]ethanol |
| SMILES | Cc1ccc(C)c(COc2ccc(Br)cc2[C@H](C)O)c1 |
| InChI | InChI=1S/C17H19BrO2/c1-11-4-5-12(2)14(8-11)10-20-17-7-6-15(18)9-16(17)13(3)19/h4-9,13,19H,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | AJQIHEHOUVVHMV-ZDUSSCGKSA-N |
| XLogP | 4.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |