C10H10N2O5S2 — CID 106265659
3-[(5-cyanothiophen-2-yl)sulfonylamino]oxolane-3-carboxylic acid (PubChem CID 106265659) has the molecular formula C10H10N2O5S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[(5-cyanothiophen-2-yl)sulfonylamino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(5-cyanothiophen-2-yl)sulfonylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106265659 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 3-[(5-cyanothiophen-2-yl)sulfonylamino]oxolane-3-carboxylic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2(C(=O)O)CCOC2)s1 |
| InChI | InChI=1S/C10H10N2O5S2/c11-5-7-1-2-8(18-7)19(15,16)12-10(9(13)14)3-4-17-6-10/h1-2,12H,3-4,6H2,(H,13,14) |
| InChIKey | GRVSWJKTJQHOPM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |