C12H17N3O3S2 — CID 106268960
2-[(5-cyanothiophen-2-yl)sulfonyl-methylamino]-N-(2-methylpropyl)acetamide (PubChem CID 106268960) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[(5-cyanothiophen-2-yl)sulfonyl-methylamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(5-cyanothiophen-2-yl)sulfonyl-methylamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 106268960 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[(5-cyanothiophen-2-yl)sulfonyl-methylamino]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN(C)S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-9(2)7-14-11(16)8-15(3)20(17,18)12-5-4-10(6-13)19-12/h4-5,9H,7-8H2,1-3H3,(H,14,16) |
| InChIKey | SRICHYPRDCWROQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |