C12H9BrF2OS — CID 106269960
2-[(3-bromo-2,6-difluorophenyl)methoxymethyl]thiophene (PubChem CID 106269960) has the molecular formula C12H9BrF2OS and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methoxymethyl]thiophene.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methoxymethyl]thiophene |
|---|---|
| PubChem CID | 106269960 |
| Molecular Formula | C12H9BrF2OS |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methoxymethyl]thiophene |
| SMILES | Fc1ccc(Br)c(F)c1COCc1cccs1 |
| InChI | InChI=1S/C12H9BrF2OS/c13-10-3-4-11(14)9(12(10)15)7-16-6-8-2-1-5-17-8/h1-5H,6-7H2 |
| InChIKey | CLLNFMALTNCSFX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|