C37H52N4O2 — CID 10627150
(6Z,10R,11S,19Z,23R,24S,25R,26R,40R)-1,14,28,38-tetrazaoctacyclo[21.16.1.110,14.010,40.011,25.026,38.027,35.029,34]hentetraconta-6,19,27(35),29,31,33-hexaene-23,24-diol (PubChem CID 10627150) has the molecular formula C37H52N4O2 and a molecular weight of 584.85 g/mol. Its IUPAC name is (6Z,10R,11S,19Z,23R,24S,25R,26R,40R)-1,14,28,38-tetrazaoctacyclo[21.16.1.110,14.010,40.011,25.026,38.027,35.029,34]hentetraconta-6,19,27(35),29,31,33-hexaene-23,24-diol.
| Compound Name | (6Z,10R,11S,19Z,23R,24S,25R,26R,40R)-1,14,28,38-tetrazaoctacyclo[21.16.1.110,14.010,40.011,25.026,38.027,35.029,34]hentetraconta-6,19,27(35),29,31,33-hexaene-23,24-diol |
|---|---|
| PubChem CID | 10627150 |
| Molecular Formula | C37H52N4O2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | (6Z,10R,11S,19Z,23R,24S,25R,26R,40R)-1,14,28,38-tetrazaoctacyclo[21.16.1.110,14.010,40.011,25.026,38.027,35.029,34]hentetraconta-6,19,27(35),29,31,33-hexaene-23,24-diol |
| SMILES | O[C@@H]1[C@@H]2[C@@H]3c4[nH]c5ccccc5c4CCN3CN3CCCC/C=C/CC[C@@]45CN(CCCC/C=C/CC[C@@]1(O)[C@@H]34)CC[C@@H]25 |
| InChI | InChI=1S/C37H52N4O2/c42-34-31-29-18-23-39-21-13-7-3-2-6-12-20-37(34,43)35-36(29,25-39)19-11-5-1-4-8-14-22-41(35)26-40-24-17-28-27-15-9-10-16-30(27)38-32(28)33(31)40/h1-2,5-6,9-10,15-16,29,31,33-35,38,42-43H,3-4,7-8,11-14,17-26H2/b5-1+,6-2+/t29-,31-,33+,34+,35-,36-,37-/m0/s1 |
| InChIKey | VCGMNYKSEGJGRF-KIUJLPLPSA-N |
| XLogP | 5.78 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|