C14H13N3O2S2 — CID 106272829
5-cyano-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-sulfonamide (PubChem CID 106272829) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-cyano-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106272829 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 5-cyano-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCCN3)s1 |
| InChI | InChI=1S/C14H13N3O2S2/c15-9-12-4-6-14(20-12)21(18,19)17-11-3-5-13-10(8-11)2-1-7-16-13/h3-6,8,16-17H,1-2,7H2 |
| InChIKey | FBVJTYJKMNZGTK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |