C13H15BrF2O — CID 106273079
3-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexan-1-ol (PubChem CID 106273079) has the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106273079 |
| Molecular Formula | C13H15BrF2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(Cc2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C13H15BrF2O/c14-11-4-5-12(15)10(13(11)16)7-8-2-1-3-9(17)6-8/h4-5,8-9,17H,1-3,6-7H2 |
| InChIKey | RWCUCDMXQAVIKM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|