C14H23N3O3 — CID 106275843
3-[(1-cyclopentyl-2,5-dioxopyrrolidin-3-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106275843) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[(1-cyclopentyl-2,5-dioxopyrrolidin-3-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(1-cyclopentyl-2,5-dioxopyrrolidin-3-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106275843 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[(1-cyclopentyl-2,5-dioxopyrrolidin-3-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNC1CC(=O)N(C2CCCC2)C1=O)C(N)=O |
| InChI | InChI=1S/C14H23N3O3/c1-14(2,13(15)20)8-16-10-7-11(18)17(12(10)19)9-5-3-4-6-9/h9-10,16H,3-8H2,1-2H3,(H2,15,20) |
| InChIKey | XZPLJSTYJRGPHC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|