C17H30N2O2 — CID 115567309
1-cyclopentyl-3-(octylamino)pyrrolidine-2,5-dione (PubChem CID 115567309) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-cyclopentyl-3-(octylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopentyl-3-(octylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 115567309 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1-cyclopentyl-3-(octylamino)pyrrolidine-2,5-dione |
| SMILES | CCCCCCCCNC1CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C17H30N2O2/c1-2-3-4-5-6-9-12-18-15-13-16(20)19(17(15)21)14-10-7-8-11-14/h14-15,18H,2-13H2,1H3 |
| InChIKey | DUFMYZYKYAFMCY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|