C12H17F3N2O2 — CID 115517814
1-cyclopropyl-3-(5,5,5-trifluoropentylamino)pyrrolidine-2,5-dione (PubChem CID 115517814) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-(5,5,5-trifluoropentylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopropyl-3-(5,5,5-trifluoropentylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 115517814 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-cyclopropyl-3-(5,5,5-trifluoropentylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCCCC(F)(F)F)C(=O)N1C1CC1 |
| InChI | InChI=1S/C12H17F3N2O2/c13-12(14,15)5-1-2-6-16-9-7-10(18)17(11(9)19)8-3-4-8/h8-9,16H,1-7H2 |
| InChIKey | MQLJMCDIGLCUSB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|