C15H25N3O4 — CID 104932992
tert-butyl N-[3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]carbamate (PubChem CID 104932992) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 104932992 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl N-[3-[(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC1CC(=O)N(C2CC2)C1=O |
| InChI | InChI=1S/C15H25N3O4/c1-15(2,3)22-14(21)17-8-4-7-16-11-9-12(19)18(13(11)20)10-5-6-10/h10-11,16H,4-9H2,1-3H3,(H,17,21) |
| InChIKey | TZLXKXSCQYHMQT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|