C13H15ClN2O2S — CID 106044348
3-[2-(5-chlorothiophen-2-yl)ethylamino]-1-cyclopropylpyrrolidine-2,5-dione (PubChem CID 106044348) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 3-[2-(5-chlorothiophen-2-yl)ethylamino]-1-cyclopropylpyrrolidine-2,5-dione.
| Compound Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]-1-cyclopropylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106044348 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]-1-cyclopropylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCc2ccc(Cl)s2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C13H15ClN2O2S/c14-11-4-3-9(19-11)5-6-15-10-7-12(17)16(13(10)18)8-1-2-8/h3-4,8,10,15H,1-2,5-7H2 |
| InChIKey | CKORDLFNLSWCQC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|