C15H18N2O2S — CID 60976656
1-cyclopropyl-3-(2-phenylsulfanylethylamino)pyrrolidine-2,5-dione (PubChem CID 60976656) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-phenylsulfanylethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopropyl-3-(2-phenylsulfanylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60976656 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-cyclopropyl-3-(2-phenylsulfanylethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCSc2ccccc2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C15H18N2O2S/c18-14-10-13(15(19)17(14)11-6-7-11)16-8-9-20-12-4-2-1-3-5-12/h1-5,11,13,16H,6-10H2 |
| InChIKey | SQEBMIJJJBBQNL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|