C13H23N3O3 — CID 106275866
3-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106275866) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275866 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CCCN1C(=O)CC(NCC(C)(C)C(=O)NC)C1=O |
| InChI | InChI=1S/C13H23N3O3/c1-5-6-16-10(17)7-9(11(16)18)15-8-13(2,3)12(19)14-4/h9,15H,5-8H2,1-4H3,(H,14,19) |
| InChIKey | CUZVDQQYPNVVTD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|