C10H17N3O4 — CID 83211649
2-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]ethyl carbamate (PubChem CID 83211649) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]ethyl carbamate.
| Compound Name | 2-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83211649 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-[(2,5-dioxo-1-propylpyrrolidin-3-yl)amino]ethyl carbamate |
| SMILES | CCCN1C(=O)CC(NCCOC(N)=O)C1=O |
| InChI | InChI=1S/C10H17N3O4/c1-2-4-13-8(14)6-7(9(13)15)12-3-5-17-10(11)16/h7,12H,2-6H2,1H3,(H2,11,16) |
| InChIKey | JLMYEGABGGSYIG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|