About N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide
N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide (PubChem CID 106276043) has the molecular formula C10H13ClN4O2
and a molecular weight of 256.69 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide |
| PubChem CID | 106276043 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide |
| SMILES | CC(C)(CNC(=O)c1ccc(Cl)nn1)C(N)=O |
| InChI | InChI=1S/C10H13ClN4O2/c1-10(2,9(12)17)5-13-8(16)6-3-4-7(11)15-14-6/h3-4H,5H2,1-2H3,(H2,12,17)(H,13,16) |
| InChIKey | WQVBHAFETKALCC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide?
The IUPAC name of N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide (CID 106276043) is N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide.
What is the SMILES notation for N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide?
The canonical SMILES for N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide is CC(C)(CNC(=O)c1ccc(Cl)nn1)C(N)=O.
What is the InChIKey of N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide?
The InChIKey is WQVBHAFETKALCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4O2/c1-10(2,9(12)17)5-13-8(16)6-3-4-7(11)15-14-6/h3-4H,5H2,1-2H3,(H2,12,17)(H,13,16).
What are the key properties of N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide?
N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide has a molecular weight of 256.69 g/mol, XLogP of 0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethyl-3-oxopropyl)-6-chloropyridazine-3-carboxamide is sourced from PubChem (CID 106276043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).