C13H18ClN3O2 — CID 106276058
N-(3-amino-2,2-dimethyl-3-oxopropyl)-2-chloro-6-ethylpyridine-4-carboxamide (PubChem CID 106276058) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-2-chloro-6-ethylpyridine-4-carboxamide.
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-2-chloro-6-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 106276058 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-2-chloro-6-ethylpyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)NCC(C)(C)C(N)=O)cc(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-4-9-5-8(6-10(14)17-9)11(18)16-7-13(2,3)12(15)19/h5-6H,4,7H2,1-3H3,(H2,15,19)(H,16,18) |
| InChIKey | QXGPDNJRMUWOCH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|