C10H22N2O2 — CID 106276316
3-[(3-hydroxy-3-methylbutyl)amino]-2,2-dimethylpropanamide (PubChem CID 106276316) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-[(3-hydroxy-3-methylbutyl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(3-hydroxy-3-methylbutyl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106276316 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-[(3-hydroxy-3-methylbutyl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(O)CCNCC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H22N2O2/c1-9(2,8(11)13)7-12-6-5-10(3,4)14/h12,14H,5-7H2,1-4H3,(H2,11,13) |
| InChIKey | WLINVNBYFDYLPY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|