C10H20N2O3 — CID 106276054
ethyl 3-[(3-amino-2,2-dimethyl-3-oxopropyl)amino]propanoate (PubChem CID 106276054) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl 3-[(3-amino-2,2-dimethyl-3-oxopropyl)amino]propanoate.
| Compound Name | ethyl 3-[(3-amino-2,2-dimethyl-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 106276054 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethyl 3-[(3-amino-2,2-dimethyl-3-oxopropyl)amino]propanoate |
| SMILES | CCOC(=O)CCNCC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H20N2O3/c1-4-15-8(13)5-6-12-7-10(2,3)9(11)14/h12H,4-7H2,1-3H3,(H2,11,14) |
| InChIKey | TZYQMCVVFZCCMC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|