About ethyl 3-(octylamino)propanoate
ethyl 3-(octylamino)propanoate (PubChem CID 46318537) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is ethyl 3-(octylamino)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(octylamino)propanoate |
| PubChem CID | 46318537 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | ethyl 3-(octylamino)propanoate |
| SMILES | CCCCCCCCNCCC(=O)OCC |
| InChI | InChI=1S/C13H27NO2/c1-3-5-6-7-8-9-11-14-12-10-13(15)16-4-2/h14H,3-12H2,1-2H3 |
| InChIKey | WNSNNEUFDRYKIV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(octylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(octylamino)propanoate?
The IUPAC name of ethyl 3-(octylamino)propanoate (CID 46318537) is ethyl 3-(octylamino)propanoate.
What is the SMILES notation for ethyl 3-(octylamino)propanoate?
The canonical SMILES for ethyl 3-(octylamino)propanoate is CCCCCCCCNCCC(=O)OCC.
What is the InChIKey of ethyl 3-(octylamino)propanoate?
The InChIKey is WNSNNEUFDRYKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-3-5-6-7-8-9-11-14-12-10-13(15)16-4-2/h14H,3-12H2,1-2H3.
What are the key properties of ethyl 3-(octylamino)propanoate?
ethyl 3-(octylamino)propanoate has a molecular weight of 229.36 g/mol, XLogP of 2.89, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(octylamino)propanoate is sourced from PubChem (CID 46318537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).