C13H16ClN3OS — CID 106276664
3-(7-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide (PubChem CID 106276664) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 3-(7-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(7-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106276664 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-(7-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(=S)[nH]c2cccc(Cl)c21 |
| InChI | InChI=1S/C13H16ClN3OS/c1-13(2,11(18)15-3)7-17-10-8(14)5-4-6-9(10)16-12(17)19/h4-6H,7H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | PXIFXNXIZVPBRJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|