About 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid
2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid (PubChem CID 106278540) has the molecular formula C9H19N3O3
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid |
| PubChem CID | 106278540 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid |
| SMILES | CNC(=O)C(C)(C)CNCC(N)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c1-9(2,8(15)11-3)5-12-4-6(10)7(13)14/h6,12H,4-5,10H2,1-3H3,(H,11,15)(H,13,14) |
| InChIKey | IROKVNXYRQZELJ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid?
The IUPAC name of 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid (CID 106278540) is 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid.
What is the SMILES notation for 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid?
The canonical SMILES for 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid is CNC(=O)C(C)(C)CNCC(N)C(=O)O.
What is the InChIKey of 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid?
The InChIKey is IROKVNXYRQZELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O3/c1-9(2,8(15)11-3)5-12-4-6(10)7(13)14/h6,12H,4-5,10H2,1-3H3,(H,11,15)(H,13,14).
What are the key properties of 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid?
2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid has a molecular weight of 217.27 g/mol, XLogP of -1.24, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]propanoic acid is sourced from PubChem (CID 106278540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).