C12H26N2O — CID 102672659
3-(3,3-dimethylbutylamino)-N,2,2-trimethylpropanamide (PubChem CID 102672659) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-(3,3-dimethylbutylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(3,3-dimethylbutylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 102672659 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3-(3,3-dimethylbutylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNCCC(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-11(2,3)7-8-14-9-12(4,5)10(15)13-6/h14H,7-9H2,1-6H3,(H,13,15) |
| InChIKey | JDMXFXFPTSXGCO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|