C10H19F3N2O — CID 106277282
N,2,2-trimethyl-3-(4,4,4-trifluorobutylamino)propanamide (PubChem CID 106277282) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(4,4,4-trifluorobutylamino)propanamide.
| Compound Name | N,2,2-trimethyl-3-(4,4,4-trifluorobutylamino)propanamide |
|---|---|
| PubChem CID | 106277282 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N,2,2-trimethyl-3-(4,4,4-trifluorobutylamino)propanamide |
| SMILES | CNC(=O)C(C)(C)CNCCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-9(2,8(16)14-3)7-15-6-4-5-10(11,12)13/h15H,4-7H2,1-3H3,(H,14,16) |
| InChIKey | NFTKVKFKBZLNPE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|