C14H19ClN4O — CID 106278840
3-[2-(1-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,2,2-trimethylpropanamide (PubChem CID 106278840) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[2-(1-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278840 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[2-(1-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(C(C)Cl)nc2cnccc21 |
| InChI | InChI=1S/C14H19ClN4O/c1-9(15)12-18-10-7-17-6-5-11(10)19(12)8-14(2,3)13(20)16-4/h5-7,9H,8H2,1-4H3,(H,16,20) |
| InChIKey | VMLGSPFPRLXYCF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|