C16H24N4O — CID 106277886
3-(5-amino-2-propan-2-ylbenzimidazol-1-yl)-N,2,2-trimethylpropanamide (PubChem CID 106277886) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 3-(5-amino-2-propan-2-ylbenzimidazol-1-yl)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(5-amino-2-propan-2-ylbenzimidazol-1-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106277886 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-(5-amino-2-propan-2-ylbenzimidazol-1-yl)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(C(C)C)nc2cc(N)ccc21 |
| InChI | InChI=1S/C16H24N4O/c1-10(2)14-19-12-8-11(17)6-7-13(12)20(14)9-16(3,4)15(21)18-5/h6-8,10H,9,17H2,1-5H3,(H,18,21) |
| InChIKey | PDOVHOGTSLKEMX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|