C18H27N3 — CID 79360481
2-propan-2-yl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine (PubChem CID 79360481) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-propan-2-yl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine.
| Compound Name | 2-propan-2-yl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 79360481 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-propan-2-yl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine |
| SMILES | CC(C)c1nc2cc(N)ccc2n1CC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H27N3/c1-11(2)16-20-13-9-12(19)7-8-14(13)21(16)10-15-17(3,4)18(15,5)6/h7-9,11,15H,10,19H2,1-6H3 |
| InChIKey | XUNIGUDJWYOREQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|