C18H25N3 — CID 79360961
2-cyclopropyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine (PubChem CID 79360961) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine.
| Compound Name | 2-cyclopropyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 79360961 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-cyclopropyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzimidazol-5-amine |
| SMILES | CC1(C)C(Cn2c(C3CC3)nc3cc(N)ccc32)C1(C)C |
| InChI | InChI=1S/C18H25N3/c1-17(2)15(18(17,3)4)10-21-14-8-7-12(19)9-13(14)20-16(21)11-5-6-11/h7-9,11,15H,5-6,10,19H2,1-4H3 |
| InChIKey | WXZRHLDKSPSNJT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|