C9H13N5OS — CID 106281487
1-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 106281487) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 106281487 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-carbamothioyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC(NC(=O)C1(C(N)=S)CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H13N5OS/c1-5(6-11-4-12-14-6)13-8(15)9(2-3-9)7(10)16/h4-5H,2-3H2,1H3,(H2,10,16)(H,13,15)(H,11,12,14) |
| InChIKey | UYYNXUWMEFCTKB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|