C13H16ClN5O — CID 106281903
2-chloro-6-propyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-4-carboxamide (PubChem CID 106281903) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 2-chloro-6-propyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-propyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106281903 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-chloro-6-propyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)NC(C)c2ncn[nH]2)cc(Cl)n1 |
| InChI | InChI=1S/C13H16ClN5O/c1-3-4-10-5-9(6-11(14)18-10)13(20)17-8(2)12-15-7-16-19-12/h5-8H,3-4H2,1-2H3,(H,17,20)(H,15,16,19) |
| InChIKey | UKMHYONPMSQSDC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|