C16H16BrClN2O — CID 107869123
N-[(1S)-1-(4-bromophenyl)ethyl]-2-chloro-6-ethylpyridine-4-carboxamide (PubChem CID 107869123) has the molecular formula C16H16BrClN2O and a molecular weight of 367.67 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-2-chloro-6-ethylpyridine-4-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-chloro-6-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107869123 |
| Molecular Formula | C16H16BrClN2O |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-chloro-6-ethylpyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)N[C@@H](C)c2ccc(Br)cc2)cc(Cl)n1 |
| InChI | InChI=1S/C16H16BrClN2O/c1-3-14-8-12(9-15(18)20-14)16(21)19-10(2)11-4-6-13(17)7-5-11/h4-10H,3H2,1-2H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | JGZYGWYVLOSVNZ-JTQLQIEISA-N |
| XLogP | 4.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|