C12H16N4O2 — CID 106282470
2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 106282470) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 106282470 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | CC(c1ncn[nH]1)N1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C12H16N4O2/c1-8(10-13-7-14-15-10)16-9(17)6-12(11(16)18)4-2-3-5-12/h7-8H,2-6H2,1H3,(H,13,14,15) |
| InChIKey | JWLHSMXZQANUCK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|