C10H12N4O2 — CID 106282474
3,4-dimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione (PubChem CID 106282474) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3,4-dimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 106282474 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3,4-dimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(C(C)c2ncn[nH]2)C1=O |
| InChI | InChI=1S/C10H12N4O2/c1-5-6(2)10(16)14(9(5)15)7(3)8-11-4-12-13-8/h4,7H,1-3H3,(H,11,12,13) |
| InChIKey | GTFKUUFLKMUTDC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|