C10H12N4O2 — CID 60976860
3-methyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione (PubChem CID 60976860) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-methyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 60976860 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-methyl-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(C(C)c2nncn2C)C1=O |
| InChI | InChI=1S/C10H12N4O2/c1-6-4-8(15)14(10(6)16)7(2)9-12-11-5-13(9)3/h4-5,7H,1-3H3 |
| InChIKey | CLJMIUDJLKJBLS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|