About 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one
1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one (PubChem CID 106282955) has the molecular formula C14H15N5O
and a molecular weight of 269.31 g/mol. Its IUPAC name is 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one |
| PubChem CID | 106282955 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one |
| SMILES | CC(Nc1cc(=O)n(C)c2ccccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C14H15N5O/c1-9(14-15-8-16-18-14)17-11-7-13(20)19(2)12-6-4-3-5-10(11)12/h3-9,17H,1-2H3,(H,15,16,18) |
| InChIKey | XKTBPKJHLMOIGD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one?
The IUPAC name of 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one (CID 106282955) is 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one.
What is the SMILES notation for 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one?
The canonical SMILES for 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one is CC(Nc1cc(=O)n(C)c2ccccc12)c1ncn[nH]1.
What is the InChIKey of 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one?
The InChIKey is XKTBPKJHLMOIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O/c1-9(14-15-8-16-18-14)17-11-7-13(20)19(2)12-6-4-3-5-10(11)12/h3-9,17H,1-2H3,(H,15,16,18).
What are the key properties of 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one?
1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one has a molecular weight of 269.31 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]quinolin-2-one is sourced from PubChem (CID 106282955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).