C10H13N5O2S — CID 114168096
2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide (PubChem CID 114168096) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 114168096 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
| SMILES | CC(Nc1ccccc1S(N)(=O)=O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H13N5O2S/c1-7(10-12-6-13-15-10)14-8-4-2-3-5-9(8)18(11,16)17/h2-7,14H,1H3,(H2,11,16,17)(H,12,13,15) |
| InChIKey | AECHOEUNAWNKJG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |