C10H14N6O2S — CID 106281269
2-amino-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide (PubChem CID 106281269) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-amino-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-amino-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106281269 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-amino-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzenesulfonamide |
| SMILES | CC(Nc1cccc(S(N)(=O)=O)c1N)c1ncn[nH]1 |
| InChI | InChI=1S/C10H14N6O2S/c1-6(10-13-5-14-16-10)15-7-3-2-4-8(9(7)11)19(12,17)18/h2-6,15H,11H2,1H3,(H2,12,17,18)(H,13,14,16) |
| InChIKey | WNRVPOBZQOOBEF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|