C10H13N5 — CID 106281307
3-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,3-diamine (PubChem CID 106281307) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,3-diamine.
| Compound Name | 3-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 106281307 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,3-diamine |
| SMILES | CC(Nc1cccc(N)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H13N5/c1-7(10-12-6-13-15-10)14-9-4-2-3-8(11)5-9/h2-7,14H,11H2,1H3,(H,12,13,15) |
| InChIKey | KXMXMPIFZBFSMN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|