C10H13N5O — CID 106283004
6-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106283004) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106283004 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | COc1cccc(NC(C)c2ncn[nH]2)n1 |
| InChI | InChI=1S/C10H13N5O/c1-7(10-11-6-12-15-10)13-8-4-3-5-9(14-8)16-2/h3-7H,1-2H3,(H,13,14)(H,11,12,15) |
| InChIKey | IHEFCVQRVADAHA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |