C10H13N5 — CID 106283037
2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine (PubChem CID 106283037) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 106283037 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-4-amine |
| SMILES | Cc1cc(NC(C)c2ncn[nH]2)ccn1 |
| InChI | InChI=1S/C10H13N5/c1-7-5-9(3-4-11-7)14-8(2)10-12-6-13-15-10/h3-6,8H,1-2H3,(H,11,14)(H,12,13,15) |
| InChIKey | GRFWWEYCGMGGPA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |