C35H72O9Si2 — CID 10628432
1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3,6,6-tetramethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-5-one (PubChem CID 10628432) has the molecular formula C35H72O9Si2 and a molecular weight of 693.12 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3,6,6-tetramethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-5-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3,6,6-tetramethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-5-one |
|---|---|
| PubChem CID | 10628432 |
| Molecular Formula | C35H72O9Si2 |
| Molecular Weight | 693.12 g/mol |
| Exact Mass | 692.47 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3,6,6-tetramethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-5-one |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)CC(CC(OC)(OC)C(=O)CC(OC)(OC)C(C)CO[Si](C)(C)C(C)(C)C)OC(C)(C)OC |
| InChI | InChI=1S/C35H72O9Si2/c1-20-28(21-22-42-45(16,17)31(3,4)5)23-29(44-33(9,10)37-11)24-35(40-14,41-15)30(36)25-34(38-12,39-13)27(2)26-43-46(18,19)32(6,7)8/h20,27-29H,1,21-26H2,2-19H3 |
| InChIKey | PNOMBIDDFZADIS-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.12 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|